C5H9N2O+ — CID 15047681
3,4,5-trimethyl-1,2,4-oxadiazol-4-ium (PubChem CID 15047681) has the molecular formula C5H9N2O+ and a molecular weight of 113.14 g/mol. Its IUPAC name is 3,4,5-trimethyl-1,2,4-oxadiazol-4-ium.
| Compound Name | 3,4,5-trimethyl-1,2,4-oxadiazol-4-ium |
|---|---|
| PubChem CID | 15047681 |
| Molecular Formula | C5H9N2O+ |
| Molecular Weight | 113.14 g/mol |
| Exact Mass | 113.07 |
| IUPAC Name | 3,4,5-trimethyl-1,2,4-oxadiazol-4-ium |
| SMILES | Cc1noc(C)[n+]1C |
| InChI | InChI=1S/C5H9N2O/c1-4-6-8-5(2)7(4)3/h1-3H3/q+1 |
| InChIKey | RYUKQQTZIAIOPL-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.14 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|