About CID 57418086
CID 57418086 (PubChem CID 57418086) has the molecular formula C5H6NO
and a molecular weight of 96.11 g/mol.
Molecular Properties
| Compound Name | CID 57418086 |
| PubChem CID | 57418086 |
| Molecular Formula | C5H6NO |
| Molecular Weight | 96.11 g/mol |
| Exact Mass | 96.04 |
| IUPAC Name | — |
| SMILES | Cc1[c]c(C)on1 |
| InChI | InChI=1S/C5H6NO/c1-4-3-5(2)7-6-4/h1-2H3 |
| InChIKey | CRKRQXXHVLRBQG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 96.11 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 57418086 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57418086?
The IUPAC name of CID 57418086 (CID 57418086) is not available.
What is the SMILES notation for CID 57418086?
The canonical SMILES for CID 57418086 is Cc1[c]c(C)on1.
What is the InChIKey of CID 57418086?
The InChIKey is CRKRQXXHVLRBQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6NO/c1-4-3-5(2)7-6-4/h1-2H3.
What are the key properties of CID 57418086?
CID 57418086 has a molecular weight of 96.11 g/mol, XLogP of 1.09, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57418086 is sourced from PubChem (CID 57418086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).