C33H42O5 — CID 15065665
(4-octoxyphenyl) 4-[4-[(2R,3S)-4-methoxy-3-methylbutan-2-yl]oxyphenyl]benzoate (PubChem CID 15065665) has the molecular formula C33H42O5 and a molecular weight of 518.69 g/mol. Its IUPAC name is (4-octoxyphenyl) 4-[4-[(2R,3S)-4-methoxy-3-methylbutan-2-yl]oxyphenyl]benzoate.
| Compound Name | (4-octoxyphenyl) 4-[4-[(2R,3S)-4-methoxy-3-methylbutan-2-yl]oxyphenyl]benzoate |
|---|---|
| PubChem CID | 15065665 |
| Molecular Formula | C33H42O5 |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | (4-octoxyphenyl) 4-[4-[(2R,3S)-4-methoxy-3-methylbutan-2-yl]oxyphenyl]benzoate |
| SMILES | CCCCCCCCOc1ccc(OC(=O)c2ccc(-c3ccc(O[C@H](C)[C@@H](C)COC)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H42O5/c1-5-6-7-8-9-10-23-36-30-19-21-32(22-20-30)38-33(34)29-13-11-27(12-14-29)28-15-17-31(18-16-28)37-26(3)25(2)24-35-4/h11-22,25-26H,5-10,23-24H2,1-4H3/t25-,26+/m0/s1 |
| InChIKey | DYBNFMYCZRSLMM-IZZNHLLZSA-N |
| XLogP | 8.36 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|