C17H24O4 — CID 15126338
[(1R,2R,3aR,7S,7aR)-3a-formyl-7-hydroxy-2,5,7-trimethylspiro[1,2,3,7a-tetrahydroindene-6,1'-cyclopropane]-1-yl] acetate (PubChem CID 15126338) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is [(1R,2R,3aR,7S,7aR)-3a-formyl-7-hydroxy-2,5,7-trimethylspiro[1,2,3,7a-tetrahydroindene-6,1'-cyclopropane]-1-yl] acetate.
| Compound Name | [(1R,2R,3aR,7S,7aR)-3a-formyl-7-hydroxy-2,5,7-trimethylspiro[1,2,3,7a-tetrahydroindene-6,1'-cyclopropane]-1-yl] acetate |
|---|---|
| PubChem CID | 15126338 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | [(1R,2R,3aR,7S,7aR)-3a-formyl-7-hydroxy-2,5,7-trimethylspiro[1,2,3,7a-tetrahydroindene-6,1'-cyclopropane]-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](C)C[C@@]2(C=O)C=C(C)C3(CC3)[C@@](C)(O)[C@@H]12 |
| InChI | InChI=1S/C17H24O4/c1-10-7-16(9-18)8-11(2)17(5-6-17)15(4,20)14(16)13(10)21-12(3)19/h8-10,13-14,20H,5-7H2,1-4H3/t10-,13-,14-,15+,16+/m1/s1 |
| InChIKey | PAAWNJHKCRRTNS-VWOPQJGGSA-N |
| XLogP | 2.25 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|