C8H13NO2S2 — CID 15156766
prop-2-ynyl N-(2,2-dimethoxyethyl)carbamodithioate (PubChem CID 15156766) has the molecular formula C8H13NO2S2 and a molecular weight of 219.33 g/mol. Its IUPAC name is prop-2-ynyl N-(2,2-dimethoxyethyl)carbamodithioate.
| Compound Name | prop-2-ynyl N-(2,2-dimethoxyethyl)carbamodithioate |
|---|---|
| PubChem CID | 15156766 |
| Molecular Formula | C8H13NO2S2 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | prop-2-ynyl N-(2,2-dimethoxyethyl)carbamodithioate |
| SMILES | C#CCSC(=S)NCC(OC)OC |
| InChI | InChI=1S/C8H13NO2S2/c1-4-5-13-8(12)9-6-7(10-2)11-3/h1,7H,5-6H2,2-3H3,(H,9,12) |
| InChIKey | WADBHRQILDORPN-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|