C25H23NO6 — CID 151666802
3-(4,9-diethoxy-1,3-dioxobenzo[f]isoindol-2-yl)-2,6-dimethylbenzoic acid (PubChem CID 151666802) has the molecular formula C25H23NO6 and a molecular weight of 433.46 g/mol. Its IUPAC name is 3-(4,9-diethoxy-1,3-dioxobenzo[f]isoindol-2-yl)-2,6-dimethylbenzoic acid.
| Compound Name | 3-(4,9-diethoxy-1,3-dioxobenzo[f]isoindol-2-yl)-2,6-dimethylbenzoic acid |
|---|---|
| PubChem CID | 151666802 |
| Molecular Formula | C25H23NO6 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 3-(4,9-diethoxy-1,3-dioxobenzo[f]isoindol-2-yl)-2,6-dimethylbenzoic acid |
| SMILES | CCOc1c2c(c(OCC)c3ccccc13)C(=O)N(c1ccc(C)c(C(=O)O)c1C)C2=O |
| InChI | InChI=1S/C25H23NO6/c1-5-31-21-15-9-7-8-10-16(15)22(32-6-2)20-19(21)23(27)26(24(20)28)17-12-11-13(3)18(14(17)4)25(29)30/h7-12H,5-6H2,1-4H3,(H,29,30) |
| InChIKey | QXRWQUJIVGISOG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|