C14H11NOS — CID 15268376
6-methylbenzo[d][1,2]benzothiazepin-7-one (PubChem CID 15268376) has the molecular formula C14H11NOS and a molecular weight of 241.32 g/mol. Its IUPAC name is 6-methylbenzo[d][1,2]benzothiazepin-7-one.
| Compound Name | 6-methylbenzo[d][1,2]benzothiazepin-7-one |
|---|---|
| PubChem CID | 15268376 |
| Molecular Formula | C14H11NOS |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 6-methylbenzo[d][1,2]benzothiazepin-7-one |
| SMILES | CN1Sc2ccccc2-c2ccccc2C1=O |
| InChI | InChI=1S/C14H11NOS/c1-15-14(16)12-8-3-2-6-10(12)11-7-4-5-9-13(11)17-15/h2-9H,1H3 |
| InChIKey | QROUYSOLOXWBOC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|