C10H9N3OS — CID 123312757
4-methyl-1,2-dihydropyrazolo[4,3-c][1,2]benzothiazin-3-one (PubChem CID 123312757) has the molecular formula C10H9N3OS and a molecular weight of 219.27 g/mol. Its IUPAC name is 4-methyl-1,2-dihydropyrazolo[4,3-c][1,2]benzothiazin-3-one.
| Compound Name | 4-methyl-1,2-dihydropyrazolo[4,3-c][1,2]benzothiazin-3-one |
|---|---|
| PubChem CID | 123312757 |
| Molecular Formula | C10H9N3OS |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 4-methyl-1,2-dihydropyrazolo[4,3-c][1,2]benzothiazin-3-one |
| SMILES | CN1Sc2ccccc2-c2[nH][nH]c(=O)c21 |
| InChI | InChI=1S/C10H9N3OS/c1-13-9-8(11-12-10(9)14)6-4-2-3-5-7(6)15-13/h2-5H,1H3,(H2,11,12,14) |
| InChIKey | HFXFCELWIAIXRZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 51.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|