About N-[diethyl(propyl)silyl]-1,2-difluorohexan-1-amine
N-[diethyl(propyl)silyl]-1,2-difluorohexan-1-amine (PubChem CID 152745318) has the molecular formula C13H29F2NSi
and a molecular weight of 265.46 g/mol. Its IUPAC name is N-[diethyl(propyl)silyl]-1,2-difluorohexan-1-amine.
Molecular Properties
| Compound Name | N-[diethyl(propyl)silyl]-1,2-difluorohexan-1-amine |
| PubChem CID | 152745318 |
| Molecular Formula | C13H29F2NSi |
| Molecular Weight | 265.46 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | N-[diethyl(propyl)silyl]-1,2-difluorohexan-1-amine |
| SMILES | CCCCC(F)C(F)N[Si](CC)(CC)CCC |
| InChI | InChI=1S/C13H29F2NSi/c1-5-9-10-12(14)13(15)16-17(7-3,8-4)11-6-2/h12-13,16H,5-11H2,1-4H3 |
| InChIKey | XUQVFGWOWNEOEB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-[diethyl(propyl)silyl]-1,2-difluorohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[diethyl(propyl)silyl]-1,2-difluorohexan-1-amine?
The IUPAC name of N-[diethyl(propyl)silyl]-1,2-difluorohexan-1-amine (CID 152745318) is N-[diethyl(propyl)silyl]-1,2-difluorohexan-1-amine.
What is the SMILES notation for N-[diethyl(propyl)silyl]-1,2-difluorohexan-1-amine?
The canonical SMILES for N-[diethyl(propyl)silyl]-1,2-difluorohexan-1-amine is CCCCC(F)C(F)N[Si](CC)(CC)CCC.
What is the InChIKey of N-[diethyl(propyl)silyl]-1,2-difluorohexan-1-amine?
The InChIKey is XUQVFGWOWNEOEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29F2NSi/c1-5-9-10-12(14)13(15)16-17(7-3,8-4)11-6-2/h12-13,16H,5-11H2,1-4H3.
What are the key properties of N-[diethyl(propyl)silyl]-1,2-difluorohexan-1-amine?
N-[diethyl(propyl)silyl]-1,2-difluorohexan-1-amine has a molecular weight of 265.46 g/mol, XLogP of 4.80, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[diethyl(propyl)silyl]-1,2-difluorohexan-1-amine is sourced from PubChem (CID 152745318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).