C20H19F4N5O3 — CID 152822159
(9S)-N-(5-fluoro-2-pyridinyl)-5-[(3R)-4,4,4-trifluoro-3-(hydroxymethyl)butanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 152822159) has the molecular formula C20H19F4N5O3 and a molecular weight of 453.40 g/mol. Its IUPAC name is (9S)-N-(5-fluoro-2-pyridinyl)-5-[(3R)-4,4,4-trifluoro-3-(hydroxymethyl)butanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-(5-fluoro-2-pyridinyl)-5-[(3R)-4,4,4-trifluoro-3-(hydroxymethyl)butanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 152822159 |
| Molecular Formula | C20H19F4N5O3 |
| Molecular Weight | 453.40 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | (9S)-N-(5-fluoro-2-pyridinyl)-5-[(3R)-4,4,4-trifluoro-3-(hydroxymethyl)butanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(C[C@H](CO)C(F)(F)F)c1ccc2c(n1)N(C(=O)Nc1ccc(F)cn1)[C@H]1CCN2C1 |
| InChI | InChI=1S/C20H19F4N5O3/c21-12-1-4-17(25-8-12)27-19(32)29-13-5-6-28(9-13)15-3-2-14(26-18(15)29)16(31)7-11(10-30)20(22,23)24/h1-4,8,11,13,30H,5-7,9-10H2,(H,25,27,32)/t11-,13+/m1/s1 |
| InChIKey | SUCQQANOWDQHII-YPMHNXCESA-N |
| XLogP | 2.99 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |