C15H15N3O — CID 15301085
6,8,9-trimethyl-11H-pyrido[3,2-c][1,5]benzodiazepin-5-one (PubChem CID 15301085) has the molecular formula C15H15N3O and a molecular weight of 253.30 g/mol. Its IUPAC name is 6,8,9-trimethyl-11H-pyrido[3,2-c][1,5]benzodiazepin-5-one.
| Compound Name | 6,8,9-trimethyl-11H-pyrido[3,2-c][1,5]benzodiazepin-5-one |
|---|---|
| PubChem CID | 15301085 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 6,8,9-trimethyl-11H-pyrido[3,2-c][1,5]benzodiazepin-5-one |
| SMILES | Cc1cc2c(cc1C)N(C)C(=O)c1cccnc1N2 |
| InChI | InChI=1S/C15H15N3O/c1-9-7-12-13(8-10(9)2)18(3)15(19)11-5-4-6-16-14(11)17-12/h4-8H,1-3H3,(H,16,17) |
| InChIKey | HFZKSKRXGCRCKY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |