C25H18N2O4 — CID 153342571
7,7'-diamino-9,9'-spirobi[fluorene]-2,2',3,3'-tetrol (PubChem CID 153342571) has the molecular formula C25H18N2O4 and a molecular weight of 410.43 g/mol. Its IUPAC name is 7,7'-diamino-9,9'-spirobi[fluorene]-2,2',3,3'-tetrol.
| Compound Name | 7,7'-diamino-9,9'-spirobi[fluorene]-2,2',3,3'-tetrol |
|---|---|
| PubChem CID | 153342571 |
| Molecular Formula | C25H18N2O4 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 7,7'-diamino-9,9'-spirobi[fluorene]-2,2',3,3'-tetrol |
| SMILES | Nc1ccc2c(c1)C1(c3cc(N)ccc3-c3cc(O)c(O)cc31)c1cc(O)c(O)cc1-2 |
| InChI | InChI=1S/C25H18N2O4/c26-11-1-3-13-15-7-21(28)23(30)9-19(15)25(17(13)5-11)18-6-12(27)2-4-14(18)16-8-22(29)24(31)10-20(16)25/h1-10,28-31H,26-27H2 |
| InChIKey | JPGMSVOTRGJINF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|