C47H83NO4 — CID 153365375
[(2R)-2-[(9Z,12Z)-octadeca-9,12-dienoxy]-4-[(9Z,12Z)-octadeca-9,12-dienyl]-2,3-dihydrofuran-5-yl]methyl 4-(dimethylamino)butanoate (PubChem CID 153365375) has the molecular formula C47H83NO4 and a molecular weight of 726.18 g/mol. Its IUPAC name is [(2R)-2-[(9Z,12Z)-octadeca-9,12-dienoxy]-4-[(9Z,12Z)-octadeca-9,12-dienyl]-2,3-dihydrofuran-5-yl]methyl 4-(dimethylamino)butanoate.
| Compound Name | [(2R)-2-[(9Z,12Z)-octadeca-9,12-dienoxy]-4-[(9Z,12Z)-octadeca-9,12-dienyl]-2,3-dihydrofuran-5-yl]methyl 4-(dimethylamino)butanoate |
|---|---|
| PubChem CID | 153365375 |
| Molecular Formula | C47H83NO4 |
| Molecular Weight | 726.18 g/mol |
| Exact Mass | 725.63 |
| IUPAC Name | [(2R)-2-[(9Z,12Z)-octadeca-9,12-dienoxy]-4-[(9Z,12Z)-octadeca-9,12-dienyl]-2,3-dihydrofuran-5-yl]methyl 4-(dimethylamino)butanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCO[C@H]1CC(CCCCCCCC/C=C\C/C=C\CCCCC)=C(COC(=O)CCCN(C)C)O1 |
| InChI | InChI=1S/C47H83NO4/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38-44-42-47(52-45(44)43-51-46(49)39-37-40-48(3)4)50-41-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,47H,5-12,17-18,23-43H2,1-4H3/b15-13-,16-14-,21-19-,22-20-/t47-/m1/s1 |
| InChIKey | YQNFXNNEYPPSML-MAFVZHOUSA-N |
| XLogP | 13.91 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.18 |
| LogP ≤ 5 | 13.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|