C56H68F2N2O6S4 — CID 153408883
3,8-difluoro-2,7-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-5,10-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]indolo[3,2-b]indole (PubChem CID 153408883) has the molecular formula C56H68F2N2O6S4 and a molecular weight of 1031.43 g/mol. Its IUPAC name is 3,8-difluoro-2,7-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-5,10-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]indolo[3,2-b]indole.
| Compound Name | 3,8-difluoro-2,7-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-5,10-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]indolo[3,2-b]indole |
|---|---|
| PubChem CID | 153408883 |
| Molecular Formula | C56H68F2N2O6S4 |
| Molecular Weight | 1031.43 g/mol |
| Exact Mass | 1030.39 |
| IUPAC Name | 3,8-difluoro-2,7-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-5,10-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]indolo[3,2-b]indole |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3cc4c(cc3F)c3c(c5cc(F)c(-c6ccc(-c7ccc(CCCCCC)s7)s6)cc5n3CCOCCOCCOC)n4CCOCCOCCOC)s2)s1 |
| InChI | InChI=1S/C56H68F2N2O6S4/c1-5-7-9-11-13-39-15-17-51(67-39)53-21-19-49(69-53)41-37-47-43(35-45(41)57)55-56(59(47)23-25-63-31-33-65-29-27-61-3)44-36-46(58)42(38-48(44)60(55)24-26-64-32-34-66-30-28-62-4)50-20-22-54(70-50)52-18-16-40(68-52)14-12-10-8-6-2/h15-22,35-38H,5-14,23-34H2,1-4H3 |
| InChIKey | SUJJTHGYVCLMEJ-UHFFFAOYSA-N |
| XLogP | 15.55 |
| TPSA | 65.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1031.43 |
| LogP ≤ 5 | 15.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|