C60H76F2N2O6S4 — CID 153408886
3,8-difluoro-5,10-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-2,7-bis[5-(5-octylthiophen-2-yl)thiophen-2-yl]indolo[3,2-b]indole (PubChem CID 153408886) has the molecular formula C60H76F2N2O6S4 and a molecular weight of 1087.54 g/mol. Its IUPAC name is 3,8-difluoro-5,10-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-2,7-bis[5-(5-octylthiophen-2-yl)thiophen-2-yl]indolo[3,2-b]indole.
| Compound Name | 3,8-difluoro-5,10-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-2,7-bis[5-(5-octylthiophen-2-yl)thiophen-2-yl]indolo[3,2-b]indole |
|---|---|
| PubChem CID | 153408886 |
| Molecular Formula | C60H76F2N2O6S4 |
| Molecular Weight | 1087.54 g/mol |
| Exact Mass | 1086.46 |
| IUPAC Name | 3,8-difluoro-5,10-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-2,7-bis[5-(5-octylthiophen-2-yl)thiophen-2-yl]indolo[3,2-b]indole |
| SMILES | CCCCCCCCc1ccc(-c2ccc(-c3cc4c(cc3F)c3c(c5cc(F)c(-c6ccc(-c7ccc(CCCCCCCC)s7)s6)cc5n3CCOCCOCCOC)n4CCOCCOCCOC)s2)s1 |
| InChI | InChI=1S/C60H76F2N2O6S4/c1-5-7-9-11-13-15-17-43-19-21-55(71-43)57-25-23-53(73-57)45-41-51-47(39-49(45)61)59-60(63(51)27-29-67-35-37-69-33-31-65-3)48-40-50(62)46(42-52(48)64(59)28-30-68-36-38-70-34-32-66-4)54-24-26-58(74-54)56-22-20-44(72-56)18-16-14-12-10-8-6-2/h19-26,39-42H,5-18,27-38H2,1-4H3 |
| InChIKey | CYGIKRRGSXABPT-UHFFFAOYSA-N |
| XLogP | 17.11 |
| TPSA | 65.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1087.54 |
| LogP ≤ 5 | 17.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|