C22H20N2O6 — CID 15350738
3-heptacyclo[7.6.0.02,7.03,14.05,12.06,10.011,15]pentadecanyl 3,5-dinitrobenzoate (PubChem CID 15350738) has the molecular formula C22H20N2O6 and a molecular weight of 408.41 g/mol. Its IUPAC name is 3-heptacyclo[7.6.0.02,7.03,14.05,12.06,10.011,15]pentadecanyl 3,5-dinitrobenzoate.
| Compound Name | 3-heptacyclo[7.6.0.02,7.03,14.05,12.06,10.011,15]pentadecanyl 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 15350738 |
| Molecular Formula | C22H20N2O6 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 3-heptacyclo[7.6.0.02,7.03,14.05,12.06,10.011,15]pentadecanyl 3,5-dinitrobenzoate |
| SMILES | O=C(OC12CC3C4CC1C1C4C4C5CC(C34)C2C51)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H20N2O6/c25-21(7-1-8(23(26)27)3-9(2-7)24(28)29)30-22-6-13-10-5-14(22)19-16(10)17-11-4-12(15(13)17)20(22)18(11)19/h1-3,10-20H,4-6H2 |
| InChIKey | LHEXCGWUFTZQCO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|