C16H20F3NO4S — CID 15372824
3-[(2-methylpropan-2-yl)oxycarbonyl-phenylsulfanylamino]propyl 2,2,2-trifluoroacetate (PubChem CID 15372824) has the molecular formula C16H20F3NO4S and a molecular weight of 379.40 g/mol. Its IUPAC name is 3-[(2-methylpropan-2-yl)oxycarbonyl-phenylsulfanylamino]propyl 2,2,2-trifluoroacetate.
| Compound Name | 3-[(2-methylpropan-2-yl)oxycarbonyl-phenylsulfanylamino]propyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 15372824 |
| Molecular Formula | C16H20F3NO4S |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 3-[(2-methylpropan-2-yl)oxycarbonyl-phenylsulfanylamino]propyl 2,2,2-trifluoroacetate |
| SMILES | CC(C)(C)OC(=O)N(CCCOC(=O)C(F)(F)F)Sc1ccccc1 |
| InChI | InChI=1S/C16H20F3NO4S/c1-15(2,3)24-14(22)20(25-12-8-5-4-6-9-12)10-7-11-23-13(21)16(17,18)19/h4-6,8-9H,7,10-11H2,1-3H3 |
| InChIKey | FFNCRWUATLJJAL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|