C31H44O5Si — CID 15382135
propan-2-yl 7-[(2S,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-oxooxolan-3-yl]heptanoate (PubChem CID 15382135) has the molecular formula C31H44O5Si and a molecular weight of 524.77 g/mol. Its IUPAC name is propan-2-yl 7-[(2S,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-oxooxolan-3-yl]heptanoate.
| Compound Name | propan-2-yl 7-[(2S,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-oxooxolan-3-yl]heptanoate |
|---|---|
| PubChem CID | 15382135 |
| Molecular Formula | C31H44O5Si |
| Molecular Weight | 524.77 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | propan-2-yl 7-[(2S,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-oxooxolan-3-yl]heptanoate |
| SMILES | CC(C)OC(=O)CCCCCC[C@H]1C(=O)CO[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H44O5Si/c1-24(2)36-30(33)21-15-7-6-14-20-27-28(32)22-34-29(27)23-35-37(31(3,4)5,25-16-10-8-11-17-25)26-18-12-9-13-19-26/h8-13,16-19,24,27,29H,6-7,14-15,20-23H2,1-5H3/t27-,29+/m0/s1 |
| InChIKey | FDEWXTOMEQDFKC-LMSSTIIKSA-N |
| XLogP | 5.44 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.77 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|