C10H8N4O2 — CID 15392040
6,8-dimethyl-2,3-dioxo-1,4-dihydropyrido[2,3-b]pyrazine-7-carbonitrile (PubChem CID 15392040) has the molecular formula C10H8N4O2 and a molecular weight of 216.20 g/mol. Its IUPAC name is 6,8-dimethyl-2,3-dioxo-1,4-dihydropyrido[2,3-b]pyrazine-7-carbonitrile.
| Compound Name | 6,8-dimethyl-2,3-dioxo-1,4-dihydropyrido[2,3-b]pyrazine-7-carbonitrile |
|---|---|
| PubChem CID | 15392040 |
| Molecular Formula | C10H8N4O2 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 6,8-dimethyl-2,3-dioxo-1,4-dihydropyrido[2,3-b]pyrazine-7-carbonitrile |
| SMILES | Cc1nc2[nH]c(=O)c(=O)[nH]c2c(C)c1C#N |
| InChI | InChI=1S/C10H8N4O2/c1-4-6(3-11)5(2)12-8-7(4)13-9(15)10(16)14-8/h1-2H3,(H,13,15)(H,12,14,16) |
| InChIKey | SFIONUFZEALXJD-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|