About 2,3-benzodioxin-4-amine
2,3-benzodioxin-4-amine (PubChem CID 154073327) has the molecular formula C8H7NO2
and a molecular weight of 149.15 g/mol. Its IUPAC name is 2,3-benzodioxin-4-amine.
Molecular Properties
| Compound Name | 2,3-benzodioxin-4-amine |
| PubChem CID | 154073327 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | 2,3-benzodioxin-4-amine |
| SMILES | NC1=c2ccccc2=COO1 |
| InChI | InChI=1S/C8H7NO2/c9-8-7-4-2-1-3-6(7)5-10-11-8/h1-5H,9H2 |
| InChIKey | QNBNWGDQTGSYSO-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2,3-benzodioxin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-benzodioxin-4-amine?
The IUPAC name of 2,3-benzodioxin-4-amine (CID 154073327) is 2,3-benzodioxin-4-amine.
What is the SMILES notation for 2,3-benzodioxin-4-amine?
The canonical SMILES for 2,3-benzodioxin-4-amine is NC1=c2ccccc2=COO1.
What is the InChIKey of 2,3-benzodioxin-4-amine?
The InChIKey is QNBNWGDQTGSYSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2/c9-8-7-4-2-1-3-6(7)5-10-11-8/h1-5H,9H2.
What are the key properties of 2,3-benzodioxin-4-amine?
2,3-benzodioxin-4-amine has a molecular weight of 149.15 g/mol, XLogP of -0.59, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-benzodioxin-4-amine is sourced from PubChem (CID 154073327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).