About 4-bromo-3H-isochromene
4-bromo-3H-isochromene (PubChem CID 141444266) has the molecular formula C9H7BrO
and a molecular weight of 211.06 g/mol. Its IUPAC name is 4-bromo-3H-isochromene.
Molecular Properties
| Compound Name | 4-bromo-3H-isochromene |
| PubChem CID | 141444266 |
| Molecular Formula | C9H7BrO |
| Molecular Weight | 211.06 g/mol |
| Exact Mass | 209.97 |
| IUPAC Name | 4-bromo-3H-isochromene |
| SMILES | BrC1=c2ccccc2=COC1 |
| InChI | InChI=1S/C9H7BrO/c10-9-6-11-5-7-3-1-2-4-8(7)9/h1-5H,6H2 |
| InChIKey | XGDAGWNNOWCBCI-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.06 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-3H-isochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3H-isochromene?
The IUPAC name of 4-bromo-3H-isochromene (CID 141444266) is 4-bromo-3H-isochromene.
What is the SMILES notation for 4-bromo-3H-isochromene?
The canonical SMILES for 4-bromo-3H-isochromene is BrC1=c2ccccc2=COC1.
What is the InChIKey of 4-bromo-3H-isochromene?
The InChIKey is XGDAGWNNOWCBCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrO/c10-9-6-11-5-7-3-1-2-4-8(7)9/h1-5H,6H2.
What are the key properties of 4-bromo-3H-isochromene?
4-bromo-3H-isochromene has a molecular weight of 211.06 g/mol, XLogP of 0.96, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3H-isochromene is sourced from PubChem (CID 141444266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).