C6H6BrF2O2- — CID 154074094
5-bromo-5,5-difluoro-2-methylpent-2-enoate (PubChem CID 154074094) has the molecular formula C6H6BrF2O2- and a molecular weight of 228.01 g/mol. Its IUPAC name is 5-bromo-5,5-difluoro-2-methylpent-2-enoate.
| Compound Name | 5-bromo-5,5-difluoro-2-methylpent-2-enoate |
|---|---|
| PubChem CID | 154074094 |
| Molecular Formula | C6H6BrF2O2- |
| Molecular Weight | 228.01 g/mol |
| Exact Mass | 226.95 |
| IUPAC Name | 5-bromo-5,5-difluoro-2-methylpent-2-enoate |
| SMILES | CC(=CCC(F)(F)Br)C(=O)[O-] |
| InChI | InChI=1S/C6H7BrF2O2/c1-4(5(10)11)2-3-6(7,8)9/h2H,3H2,1H3,(H,10,11)/p-1 |
| InChIKey | LBJJZHYXWZQWKQ-UHFFFAOYSA-M |
| XLogP | 1.06 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.01 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|