C8H8Br3S+ — CID 154075909
dimethyl-(2,4,6-tribromophenyl)sulfanium (PubChem CID 154075909) has the molecular formula C8H8Br3S+ and a molecular weight of 375.93 g/mol. Its IUPAC name is dimethyl-(2,4,6-tribromophenyl)sulfanium.
| Compound Name | dimethyl-(2,4,6-tribromophenyl)sulfanium |
|---|---|
| PubChem CID | 154075909 |
| Molecular Formula | C8H8Br3S+ |
| Molecular Weight | 375.93 g/mol |
| Exact Mass | 372.79 |
| IUPAC Name | dimethyl-(2,4,6-tribromophenyl)sulfanium |
| SMILES | C[S+](C)c1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C8H8Br3S/c1-12(2)8-6(10)3-5(9)4-7(8)11/h3-4H,1-2H3/q+1 |
| InChIKey | JMLQRECKAMADSW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.93 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|