C14H22OSi — CID 154080236
ethoxy(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)silane (PubChem CID 154080236) has the molecular formula C14H22OSi and a molecular weight of 234.41 g/mol. Its IUPAC name is ethoxy(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)silane.
| Compound Name | ethoxy(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)silane |
|---|---|
| PubChem CID | 154080236 |
| Molecular Formula | C14H22OSi |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | ethoxy(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)silane |
| SMILES | CCO[SiH2]C1CC2CC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C14H22OSi/c1-2-15-16-12-7-10-6-11(12)14-9-4-3-8(5-9)13(10)14/h3-4,8-14H,2,5-7,16H2,1H3 |
| InChIKey | ACKCAPZEOAPHIH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|