C5H8N4O — CID 154124885
2,3,6,7-tetrahydro-1H-imidazo[2,1-c][1,2,4]triazin-4-one (PubChem CID 154124885) has the molecular formula C5H8N4O and a molecular weight of 140.15 g/mol. Its IUPAC name is 2,3,6,7-tetrahydro-1H-imidazo[2,1-c][1,2,4]triazin-4-one.
| Compound Name | 2,3,6,7-tetrahydro-1H-imidazo[2,1-c][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 154124885 |
| Molecular Formula | C5H8N4O |
| Molecular Weight | 140.15 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | 2,3,6,7-tetrahydro-1H-imidazo[2,1-c][1,2,4]triazin-4-one |
| SMILES | O=C1CNNC2=NCCN12 |
| InChI | InChI=1S/C5H8N4O/c10-4-3-7-8-5-6-1-2-9(4)5/h7H,1-3H2,(H,6,8) |
| InChIKey | FGRBZQIABWTXOQ-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.15 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |