About 2-[5-(trifluoromethyl)-1,2,4-triazol-1-yl]benzamide
2-[5-(trifluoromethyl)-1,2,4-triazol-1-yl]benzamide (PubChem CID 154147685) has the molecular formula C10H7F3N4O
and a molecular weight of 256.19 g/mol. Its IUPAC name is 2-[5-(trifluoromethyl)-1,2,4-triazol-1-yl]benzamide.
Molecular Properties
| Compound Name | 2-[5-(trifluoromethyl)-1,2,4-triazol-1-yl]benzamide |
| PubChem CID | 154147685 |
| Molecular Formula | C10H7F3N4O |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 2-[5-(trifluoromethyl)-1,2,4-triazol-1-yl]benzamide |
| SMILES | NC(=O)c1ccccc1-n1ncnc1C(F)(F)F |
| InChI | InChI=1S/C10H7F3N4O/c11-10(12,13)9-15-5-16-17(9)7-4-2-1-3-6(7)8(14)18/h1-5H,(H2,14,18) |
| InChIKey | ZDKXRARTMYJPMZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-(trifluoromethyl)-1,2,4-triazol-1-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(trifluoromethyl)-1,2,4-triazol-1-yl]benzamide?
The IUPAC name of 2-[5-(trifluoromethyl)-1,2,4-triazol-1-yl]benzamide (CID 154147685) is 2-[5-(trifluoromethyl)-1,2,4-triazol-1-yl]benzamide.
What is the SMILES notation for 2-[5-(trifluoromethyl)-1,2,4-triazol-1-yl]benzamide?
The canonical SMILES for 2-[5-(trifluoromethyl)-1,2,4-triazol-1-yl]benzamide is NC(=O)c1ccccc1-n1ncnc1C(F)(F)F.
What is the InChIKey of 2-[5-(trifluoromethyl)-1,2,4-triazol-1-yl]benzamide?
The InChIKey is ZDKXRARTMYJPMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F3N4O/c11-10(12,13)9-15-5-16-17(9)7-4-2-1-3-6(7)8(14)18/h1-5H,(H2,14,18).
What are the key properties of 2-[5-(trifluoromethyl)-1,2,4-triazol-1-yl]benzamide?
2-[5-(trifluoromethyl)-1,2,4-triazol-1-yl]benzamide has a molecular weight of 256.19 g/mol, XLogP of 1.38, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(trifluoromethyl)-1,2,4-triazol-1-yl]benzamide is sourced from PubChem (CID 154147685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).