C14H6F24O24S8Si4 — CID 154179826
[trifluoromethylsulfonyloxy-[2,3,4-tris[bis(trifluoromethylsulfonyloxy)silyl]phenyl]silyl] trifluoromethanesulfonate (PubChem CID 154179826) has the molecular formula C14H6F24O24S8Si4 and a molecular weight of 1383.01 g/mol. Its IUPAC name is [trifluoromethylsulfonyloxy-[2,3,4-tris[bis(trifluoromethylsulfonyloxy)silyl]phenyl]silyl] trifluoromethanesulfonate.
| Compound Name | [trifluoromethylsulfonyloxy-[2,3,4-tris[bis(trifluoromethylsulfonyloxy)silyl]phenyl]silyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 154179826 |
| Molecular Formula | C14H6F24O24S8Si4 |
| Molecular Weight | 1383.01 g/mol |
| Exact Mass | 1381.57 |
| IUPAC Name | [trifluoromethylsulfonyloxy-[2,3,4-tris[bis(trifluoromethylsulfonyloxy)silyl]phenyl]silyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(O[SiH](OS(=O)(=O)C(F)(F)F)c1ccc([SiH](OS(=O)(=O)C(F)(F)F)OS(=O)(=O)C(F)(F)F)c([SiH](OS(=O)(=O)C(F)(F)F)OS(=O)(=O)C(F)(F)F)c1[SiH](OS(=O)(=O)C(F)(F)F)OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H6F24O24S8Si4/c15-7(16,17)63(39,40)55-71(56-64(41,42)8(18,19)20)3-1-2-4(72(57-65(43,44)9(21,22)23)58-66(45,46)10(24,25)26)6(74(61-69(51,52)13(33,34)35)62-70(53,54)14(36,37)38)5(3)73(59-67(47,48)11(27,28)29)60-68(49,50)12(30,31)32/h1-2,71-74H |
| InChIKey | KGTBNWHNQJDSQF-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 346.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1383.01 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|