C27H32N4O4S2 — CID 154428209
3-[(2S)-2-amino-3-oxo-3-(1,3-thiazol-2-yl)propyl]-N'-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl]benzenecarboximidamide (PubChem CID 154428209) has the molecular formula C27H32N4O4S2 and a molecular weight of 540.71 g/mol. Its IUPAC name is 3-[(2S)-2-amino-3-oxo-3-(1,3-thiazol-2-yl)propyl]-N'-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl]benzenecarboximidamide.
| Compound Name | 3-[(2S)-2-amino-3-oxo-3-(1,3-thiazol-2-yl)propyl]-N'-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 154428209 |
| Molecular Formula | C27H32N4O4S2 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | 3-[(2S)-2-amino-3-oxo-3-(1,3-thiazol-2-yl)propyl]-N'-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl]benzenecarboximidamide |
| SMILES | Cc1c(C)c(S(=O)(=O)N=C(N)c2cccc(C[C@H](N)C(=O)c3nccs3)c2)c(C)c2c1OC(C)(C)CC2 |
| InChI | InChI=1S/C27H32N4O4S2/c1-15-16(2)24(17(3)20-9-10-27(4,5)35-23(15)20)37(33,34)31-25(29)19-8-6-7-18(13-19)14-21(28)22(32)26-30-11-12-36-26/h6-8,11-13,21H,9-10,14,28H2,1-5H3,(H2,29,31)/t21-/m0/s1 |
| InChIKey | IIHTXKWEPZIQLK-NRFANRHFSA-N |
| XLogP | 4.02 |
| TPSA | 137.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|