C27H34O4 — CID 154601506
[2-(hydroxymethyl)-6-(2-phenyl-1-benzofuran-6-yl)hexyl] 2,2-dimethylbutanoate (PubChem CID 154601506) has the molecular formula C27H34O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is [2-(hydroxymethyl)-6-(2-phenyl-1-benzofuran-6-yl)hexyl] 2,2-dimethylbutanoate.
| Compound Name | [2-(hydroxymethyl)-6-(2-phenyl-1-benzofuran-6-yl)hexyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 154601506 |
| Molecular Formula | C27H34O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | [2-(hydroxymethyl)-6-(2-phenyl-1-benzofuran-6-yl)hexyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC(CO)CCCCc1ccc2cc(-c3ccccc3)oc2c1 |
| InChI | InChI=1S/C27H34O4/c1-4-27(2,3)26(29)30-19-21(18-28)11-9-8-10-20-14-15-23-17-25(31-24(23)16-20)22-12-6-5-7-13-22/h5-7,12-17,21,28H,4,8-11,18-19H2,1-3H3 |
| InChIKey | NAEDNUXXAQVOEW-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|