C16H18F3NO3 — CID 154640823
2,2,2-trifluoroethyl N-(4,4-dimethyl-1-phenylpent-2-ynyl)-N-hydroxycarbamate (PubChem CID 154640823) has the molecular formula C16H18F3NO3 and a molecular weight of 329.32 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-(4,4-dimethyl-1-phenylpent-2-ynyl)-N-hydroxycarbamate.
| Compound Name | 2,2,2-trifluoroethyl N-(4,4-dimethyl-1-phenylpent-2-ynyl)-N-hydroxycarbamate |
|---|---|
| PubChem CID | 154640823 |
| Molecular Formula | C16H18F3NO3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 2,2,2-trifluoroethyl N-(4,4-dimethyl-1-phenylpent-2-ynyl)-N-hydroxycarbamate |
| SMILES | CC(C)(C)C#CC(c1ccccc1)N(O)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C16H18F3NO3/c1-15(2,3)10-9-13(12-7-5-4-6-8-12)20(22)14(21)23-11-16(17,18)19/h4-8,13,22H,11H2,1-3H3 |
| InChIKey | IMNFERBSQWBSDS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|