C14H13F3N2O2S — CID 154674453
4-hydroxy-6-oxo-N-phenyl-1-(2,2,2-trifluoroethyl)-2,3-dihydropyridine-5-carbothioamide (PubChem CID 154674453) has the molecular formula C14H13F3N2O2S and a molecular weight of 330.33 g/mol. Its IUPAC name is 4-hydroxy-6-oxo-N-phenyl-1-(2,2,2-trifluoroethyl)-2,3-dihydropyridine-5-carbothioamide.
| Compound Name | 4-hydroxy-6-oxo-N-phenyl-1-(2,2,2-trifluoroethyl)-2,3-dihydropyridine-5-carbothioamide |
|---|---|
| PubChem CID | 154674453 |
| Molecular Formula | C14H13F3N2O2S |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 4-hydroxy-6-oxo-N-phenyl-1-(2,2,2-trifluoroethyl)-2,3-dihydropyridine-5-carbothioamide |
| SMILES | O=C1C(C(=S)Nc2ccccc2)=C(O)CCN1CC(F)(F)F |
| InChI | InChI=1S/C14H13F3N2O2S/c15-14(16,17)8-19-7-6-10(20)11(13(19)21)12(22)18-9-4-2-1-3-5-9/h1-5,20H,6-8H2,(H,18,22) |
| InChIKey | LFRLQXSYKALFQU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|