C7H7- — CID 154710056
1-(1,2,2-trideuterioethenyl)cyclopenta-1,3-diene (PubChem CID 154710056) has the molecular formula C7H7- and a molecular weight of 94.15 g/mol. Its IUPAC name is 1-(1,2,2-trideuterioethenyl)cyclopenta-1,3-diene.
| Compound Name | 1-(1,2,2-trideuterioethenyl)cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 154710056 |
| Molecular Formula | C7H7- |
| Molecular Weight | 94.15 g/mol |
| Exact Mass | 94.07 |
| IUPAC Name | 1-(1,2,2-trideuterioethenyl)cyclopenta-1,3-diene |
| SMILES | [2H]C([2H])=C([2H])c1ccc[cH-]1 |
| InChI | InChI=1S/C7H7/c1-2-7-5-3-4-6-7/h2-6H,1H2/q-1/i1D2,2D |
| InChIKey | IBLJSQHSQVWTNN-FUDHJZNOSA-N |
| XLogP | 2.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 94.15 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|