C15H18O7 — CID 154718149
(1S,4S,9R,11S)-9-tert-butyl-9-hydroxy-3,5,12-trioxatetracyclo[6.6.0.01,11.04,8]tetradecane-2,6,13-trione (PubChem CID 154718149) has the molecular formula C15H18O7 and a molecular weight of 310.30 g/mol. Its IUPAC name is (1S,4S,9R,11S)-9-tert-butyl-9-hydroxy-3,5,12-trioxatetracyclo[6.6.0.01,11.04,8]tetradecane-2,6,13-trione.
| Compound Name | (1S,4S,9R,11S)-9-tert-butyl-9-hydroxy-3,5,12-trioxatetracyclo[6.6.0.01,11.04,8]tetradecane-2,6,13-trione |
|---|---|
| PubChem CID | 154718149 |
| Molecular Formula | C15H18O7 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (1S,4S,9R,11S)-9-tert-butyl-9-hydroxy-3,5,12-trioxatetracyclo[6.6.0.01,11.04,8]tetradecane-2,6,13-trione |
| SMILES | CC(C)(C)[C@]1(O)C[C@@H]2OC(=O)C[C@@]23C(=O)O[C@@H]2OC(=O)CC213 |
| InChI | InChI=1S/C15H18O7/c1-12(2,3)15(19)4-7-13(5-8(16)20-7)10(18)22-11-14(13,15)6-9(17)21-11/h7,11,19H,4-6H2,1-3H3/t7-,11-,13-,14?,15+/m0/s1 |
| InChIKey | TUDMVZPIKRLXKX-RNTSOJBZSA-N |
| XLogP | 0.29 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |