C17H21N3O3 — CID 154757217
1-N-(2,3-dimethyl-1-benzofuran-5-yl)piperidine-1,3-dicarboxamide (PubChem CID 154757217) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 1-N-(2,3-dimethyl-1-benzofuran-5-yl)piperidine-1,3-dicarboxamide.
| Compound Name | 1-N-(2,3-dimethyl-1-benzofuran-5-yl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 154757217 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 1-N-(2,3-dimethyl-1-benzofuran-5-yl)piperidine-1,3-dicarboxamide |
| SMILES | Cc1oc2ccc(NC(=O)N3CCCC(C(N)=O)C3)cc2c1C |
| InChI | InChI=1S/C17H21N3O3/c1-10-11(2)23-15-6-5-13(8-14(10)15)19-17(22)20-7-3-4-12(9-20)16(18)21/h5-6,8,12H,3-4,7,9H2,1-2H3,(H2,18,21)(H,19,22) |
| InChIKey | ICYXJQINIYWGAP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |