C19H29F3N2O2 — CID 154819100
2-cyclopentyl-N-[[(1S,5S,6R,7R)-3-(3,3,3-trifluoropropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]acetamide (PubChem CID 154819100) has the molecular formula C19H29F3N2O2 and a molecular weight of 374.45 g/mol. Its IUPAC name is 2-cyclopentyl-N-[[(1S,5S,6R,7R)-3-(3,3,3-trifluoropropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]acetamide.
| Compound Name | 2-cyclopentyl-N-[[(1S,5S,6R,7R)-3-(3,3,3-trifluoropropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]acetamide |
|---|---|
| PubChem CID | 154819100 |
| Molecular Formula | C19H29F3N2O2 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 2-cyclopentyl-N-[[(1S,5S,6R,7R)-3-(3,3,3-trifluoropropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]acetamide |
| SMILES | O=C(CC1CCCC1)NC[C@H]1[C@H]2CN(CCC(F)(F)F)C[C@]23CC[C@H]1O3 |
| InChI | InChI=1S/C19H29F3N2O2/c20-19(21,22)7-8-24-11-15-14(16-5-6-18(15,12-24)26-16)10-23-17(25)9-13-3-1-2-4-13/h13-16H,1-12H2,(H,23,25)/t14-,15+,16+,18+/m0/s1 |
| InChIKey | WEIBREFDXUVRKT-BVIKNXMNSA-N |
| XLogP | 3.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |