C15H21NO3S2 — CID 154871031
N-(2,4-dihydroxy-2-methylbutyl)-4-(1,3-dithiolan-2-yl)benzamide (PubChem CID 154871031) has the molecular formula C15H21NO3S2 and a molecular weight of 327.47 g/mol. Its IUPAC name is N-(2,4-dihydroxy-2-methylbutyl)-4-(1,3-dithiolan-2-yl)benzamide.
| Compound Name | N-(2,4-dihydroxy-2-methylbutyl)-4-(1,3-dithiolan-2-yl)benzamide |
|---|---|
| PubChem CID | 154871031 |
| Molecular Formula | C15H21NO3S2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N-(2,4-dihydroxy-2-methylbutyl)-4-(1,3-dithiolan-2-yl)benzamide |
| SMILES | CC(O)(CCO)CNC(=O)c1ccc(C2SCCS2)cc1 |
| InChI | InChI=1S/C15H21NO3S2/c1-15(19,6-7-17)10-16-13(18)11-2-4-12(5-3-11)14-20-8-9-21-14/h2-5,14,17,19H,6-10H2,1H3,(H,16,18) |
| InChIKey | VSCVTOHSOUFYPI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |