C15H18O3 — CID 15496050
6-[(2E)-octa-2,7-dienyl]-1,3-benzodioxol-5-ol (PubChem CID 15496050) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is 6-[(2E)-octa-2,7-dienyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[(2E)-octa-2,7-dienyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 15496050 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 6-[(2E)-octa-2,7-dienyl]-1,3-benzodioxol-5-ol |
| SMILES | C=CCCC/C=C/Cc1cc2c(cc1O)OCO2 |
| InChI | InChI=1S/C15H18O3/c1-2-3-4-5-6-7-8-12-9-14-15(10-13(12)16)18-11-17-14/h2,6-7,9-10,16H,1,3-5,8,11H2/b7-6+ |
| InChIKey | UJANKXRXLZRTGZ-VOTSOKGWSA-N |
| XLogP | 3.58 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|