C32H35N3O3S — CID 154989428
(E)-2-methyl-3-[3-(4-propoxyphenyl)phenyl]-N-[4-[(S)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide (PubChem CID 154989428) has the molecular formula C32H35N3O3S and a molecular weight of 541.72 g/mol. Its IUPAC name is (E)-2-methyl-3-[3-(4-propoxyphenyl)phenyl]-N-[4-[(S)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide.
| Compound Name | (E)-2-methyl-3-[3-(4-propoxyphenyl)phenyl]-N-[4-[(S)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 154989428 |
| Molecular Formula | C32H35N3O3S |
| Molecular Weight | 541.72 g/mol |
| Exact Mass | 541.24 |
| IUPAC Name | (E)-2-methyl-3-[3-(4-propoxyphenyl)phenyl]-N-[4-[(S)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide |
| SMILES | CCCOc1ccc(-c2cccc(/C=C(\C)C(=O)Nc3ccc([S@@](=O)Cc4cncn4CCC)cc3)c2)cc1 |
| InChI | InChI=1S/C32H35N3O3S/c1-4-17-35-23-33-21-29(35)22-39(37)31-15-11-28(12-16-31)34-32(36)24(3)19-25-7-6-8-27(20-25)26-9-13-30(14-10-26)38-18-5-2/h6-16,19-21,23H,4-5,17-18,22H2,1-3H3,(H,34,36)/b24-19+/t39-/m0/s1 |
| InChIKey | RMIUSRHMVRILTI-VBOQCTLFSA-N |
| XLogP | 7.10 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.72 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|