C28H38N4O8 — CID 155023483
2-[methyl-[3-methyl-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoyl]amino]ethyl N-[4-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-4-oxobutyl]carbamate (PubChem CID 155023483) has the molecular formula C28H38N4O8 and a molecular weight of 558.63 g/mol. Its IUPAC name is 2-[methyl-[3-methyl-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoyl]amino]ethyl N-[4-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-4-oxobutyl]carbamate.
| Compound Name | 2-[methyl-[3-methyl-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoyl]amino]ethyl N-[4-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 155023483 |
| Molecular Formula | C28H38N4O8 |
| Molecular Weight | 558.63 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | 2-[methyl-[3-methyl-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoyl]amino]ethyl N-[4-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-4-oxobutyl]carbamate |
| SMILES | CC1=C(C)C(=O)C(C(C)(C)CC(=O)N(C)CCOC(=O)NCCCC(=O)NCCN2C(=O)C=CC2=O)=C(C)C1=O |
| InChI | InChI=1S/C28H38N4O8/c1-17-18(2)26(38)24(19(3)25(17)37)28(4,5)16-23(36)31(6)14-15-40-27(39)30-11-7-8-20(33)29-12-13-32-21(34)9-10-22(32)35/h9-10H,7-8,11-16H2,1-6H3,(H,29,33)(H,30,39) |
| InChIKey | OUUYCSROEORQMS-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 159.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.63 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|