C24H21F2N3O2 — CID 155049208
5-[[(1R,8R)-5-(2,6-difluorophenyl)-10,11-dimethyl-3,4-diazatetracyclo[6.3.2.02,7.09,11]trideca-2,4,6-trien-1-yl]oxy]-1H-pyridin-2-one (PubChem CID 155049208) has the molecular formula C24H21F2N3O2 and a molecular weight of 421.45 g/mol. Its IUPAC name is 5-[[(1R,8R)-5-(2,6-difluorophenyl)-10,11-dimethyl-3,4-diazatetracyclo[6.3.2.02,7.09,11]trideca-2,4,6-trien-1-yl]oxy]-1H-pyridin-2-one.
| Compound Name | 5-[[(1R,8R)-5-(2,6-difluorophenyl)-10,11-dimethyl-3,4-diazatetracyclo[6.3.2.02,7.09,11]trideca-2,4,6-trien-1-yl]oxy]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 155049208 |
| Molecular Formula | C24H21F2N3O2 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 5-[[(1R,8R)-5-(2,6-difluorophenyl)-10,11-dimethyl-3,4-diazatetracyclo[6.3.2.02,7.09,11]trideca-2,4,6-trien-1-yl]oxy]-1H-pyridin-2-one |
| SMILES | CC1C2[C@H]3CC[C@](Oc4ccc(=O)[nH]c4)(c4nnc(-c5c(F)cccc5F)cc43)C12C |
| InChI | InChI=1S/C24H21F2N3O2/c1-12-21-14-8-9-24(23(12,21)2,31-13-6-7-19(30)27-11-13)22-15(14)10-18(28-29-22)20-16(25)4-3-5-17(20)26/h3-7,10-12,14,21H,8-9H2,1-2H3,(H,27,30)/t12?,14-,21?,23?,24-/m0/s1 |
| InChIKey | WLAGVPZWAQWPPQ-UDPPTYCQSA-N |
| XLogP | 4.55 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |