C16H16FN3 — CID 155120309
2-fluoro-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N-methylquinazolin-4-amine (PubChem CID 155120309) has the molecular formula C16H16FN3 and a molecular weight of 269.32 g/mol. Its IUPAC name is 2-fluoro-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N-methylquinazolin-4-amine.
| Compound Name | 2-fluoro-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N-methylquinazolin-4-amine |
|---|---|
| PubChem CID | 155120309 |
| Molecular Formula | C16H16FN3 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-fluoro-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N-methylquinazolin-4-amine |
| SMILES | C=C/C=C(\C=C/C)N(C)c1nc(F)nc2ccccc12 |
| InChI | InChI=1S/C16H16FN3/c1-4-8-12(9-5-2)20(3)15-13-10-6-7-11-14(13)18-16(17)19-15/h4-11H,1H2,2-3H3/b9-5-,12-8+ |
| InChIKey | MUAYNVIVYGJUJV-ZYEZJADKSA-N |
| XLogP | 3.85 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|