C27H48O5Si — CID 15516701
methyl 3-[(3S,3aS,5aS,6R,9aS,9bS)-3-[tert-butyl(dimethyl)silyl]oxy-3a,6-dimethylspiro[1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalene-7,2'-1,3-dioxolane]-6-yl]propanoate (PubChem CID 15516701) has the molecular formula C27H48O5Si and a molecular weight of 480.76 g/mol. Its IUPAC name is methyl 3-[(3S,3aS,5aS,6R,9aS,9bS)-3-[tert-butyl(dimethyl)silyl]oxy-3a,6-dimethylspiro[1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalene-7,2'-1,3-dioxolane]-6-yl]propanoate.
| Compound Name | methyl 3-[(3S,3aS,5aS,6R,9aS,9bS)-3-[tert-butyl(dimethyl)silyl]oxy-3a,6-dimethylspiro[1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalene-7,2'-1,3-dioxolane]-6-yl]propanoate |
|---|---|
| PubChem CID | 15516701 |
| Molecular Formula | C27H48O5Si |
| Molecular Weight | 480.76 g/mol |
| Exact Mass | 480.33 |
| IUPAC Name | methyl 3-[(3S,3aS,5aS,6R,9aS,9bS)-3-[tert-butyl(dimethyl)silyl]oxy-3a,6-dimethylspiro[1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalene-7,2'-1,3-dioxolane]-6-yl]propanoate |
| SMILES | COC(=O)CC[C@]1(C)[C@H]2CC[C@]3(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@H]3[C@@H]2CCC12OCCO2 |
| InChI | InChI=1S/C27H48O5Si/c1-24(2,3)33(7,8)32-22-10-9-20-19-11-16-27(30-17-18-31-27)26(5,15-13-23(28)29-6)21(19)12-14-25(20,22)4/h19-22H,9-18H2,1-8H3/t19-,20-,21-,22-,25-,26+/m0/s1 |
| InChIKey | ZITWMCHTJPOJRG-IRMULARKSA-N |
| XLogP | 6.32 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.76 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|