C54H97NO8 — CID 155210210
[2-methyl-3-[(Z)-tetradec-9-enoyl]oxy-2-[[(Z)-tetradec-9-enoyl]oxymethyl]propyl] (Z)-3-[5-(dimethylamino)pentanoyloxy]tetradec-9-enoate (PubChem CID 155210210) has the molecular formula C54H97NO8 and a molecular weight of 888.37 g/mol. Its IUPAC name is [2-methyl-3-[(Z)-tetradec-9-enoyl]oxy-2-[[(Z)-tetradec-9-enoyl]oxymethyl]propyl] (Z)-3-[5-(dimethylamino)pentanoyloxy]tetradec-9-enoate.
| Compound Name | [2-methyl-3-[(Z)-tetradec-9-enoyl]oxy-2-[[(Z)-tetradec-9-enoyl]oxymethyl]propyl] (Z)-3-[5-(dimethylamino)pentanoyloxy]tetradec-9-enoate |
|---|---|
| PubChem CID | 155210210 |
| Molecular Formula | C54H97NO8 |
| Molecular Weight | 888.37 g/mol |
| Exact Mass | 887.72 |
| IUPAC Name | [2-methyl-3-[(Z)-tetradec-9-enoyl]oxy-2-[[(Z)-tetradec-9-enoyl]oxymethyl]propyl] (Z)-3-[5-(dimethylamino)pentanoyloxy]tetradec-9-enoate |
| SMILES | CCCC/C=C\CCCCCCCC(=O)OCC(C)(COC(=O)CCCCCCC/C=C\CCCC)COC(=O)CC(CCCCC/C=C\CCCC)OC(=O)CCCCN(C)C |
| InChI | InChI=1S/C54H97NO8/c1-7-10-13-16-19-22-24-27-30-33-36-41-50(56)60-46-54(4,47-61-51(57)42-37-34-31-28-25-23-20-17-14-11-8-2)48-62-53(59)45-49(63-52(58)43-38-39-44-55(5)6)40-35-32-29-26-21-18-15-12-9-3/h16-21,49H,7-15,22-48H2,1-6H3/b19-16-,20-17-,21-18- |
| InChIKey | PWONSRYSMPPDCO-JFJOQQEJSA-N |
| XLogP | 14.31 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.37 |
| LogP ≤ 5 | 14.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|