C16H14ClF2N3OS — CID 155266419
5-(2-chloro-3,5-difluorophenyl)-N-(2-methoxyethyl)-4H-1,2,4-benzothiadiazin-3-imine (PubChem CID 155266419) has the molecular formula C16H14ClF2N3OS and a molecular weight of 369.82 g/mol. Its IUPAC name is 5-(2-chloro-3,5-difluorophenyl)-N-(2-methoxyethyl)-4H-1,2,4-benzothiadiazin-3-imine.
| Compound Name | 5-(2-chloro-3,5-difluorophenyl)-N-(2-methoxyethyl)-4H-1,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 155266419 |
| Molecular Formula | C16H14ClF2N3OS |
| Molecular Weight | 369.82 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 5-(2-chloro-3,5-difluorophenyl)-N-(2-methoxyethyl)-4H-1,2,4-benzothiadiazin-3-imine |
| SMILES | COCC/N=C1\NSc2cccc(-c3cc(F)cc(F)c3Cl)c2N1 |
| InChI | InChI=1S/C16H14ClF2N3OS/c1-23-6-5-20-16-21-15-10(3-2-4-13(15)24-22-16)11-7-9(18)8-12(19)14(11)17/h2-4,7-8H,5-6H2,1H3,(H2,20,21,22) |
| InChIKey | NXJDNMBNXHIQHB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.82 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|