C20H20F12O2 — CID 155471208
1,1,1,3,3,3-hexafluoropropan-2-yl 3-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-propan-2-ylpentanoate (PubChem CID 155471208) has the molecular formula C20H20F12O2 and a molecular weight of 520.35 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 3-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-propan-2-ylpentanoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 3-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 155471208 |
| Molecular Formula | C20H20F12O2 |
| Molecular Weight | 520.35 g/mol |
| Exact Mass | 520.13 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 3-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-propan-2-ylpentanoate |
| SMILES | CC(C)C(C(=O)OC(C(F)(F)F)C(F)(F)F)C(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(C)C |
| InChI | InChI=1S/C20H20F12O2/c1-8(2)13(10-5-11(17(21,22)23)7-12(6-10)18(24,25)26)14(9(3)4)15(33)34-16(19(27,28)29)20(30,31)32/h5-9,13-14,16H,1-4H3 |
| InChIKey | FFBPBJHFCGGPIS-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.35 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |