C23H25N9O — CID 155535492
29-amino-2,6,14,22,26,28,30,31-octazapentacyclo[25.3.1.07,16.08,13.015,20]hentriaconta-1(31),7(16),8,10,12,14,17,19,27,29-decaen-21-one (PubChem CID 155535492) has the molecular formula C23H25N9O and a molecular weight of 443.52 g/mol. Its IUPAC name is 29-amino-2,6,14,22,26,28,30,31-octazapentacyclo[25.3.1.07,16.08,13.015,20]hentriaconta-1(31),7(16),8,10,12,14,17,19,27,29-decaen-21-one.
| Compound Name | 29-amino-2,6,14,22,26,28,30,31-octazapentacyclo[25.3.1.07,16.08,13.015,20]hentriaconta-1(31),7(16),8,10,12,14,17,19,27,29-decaen-21-one |
|---|---|
| PubChem CID | 155535492 |
| Molecular Formula | C23H25N9O |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 29-amino-2,6,14,22,26,28,30,31-octazapentacyclo[25.3.1.07,16.08,13.015,20]hentriaconta-1(31),7(16),8,10,12,14,17,19,27,29-decaen-21-one |
| SMILES | Nc1nc2nc(n1)NCCCNc1c3ccccc3nc3c(cccc13)C(=O)NCCCN2 |
| InChI | InChI=1S/C23H25N9O/c24-21-30-22-27-12-4-10-25-18-14-6-1-2-9-17(14)29-19-15(18)7-3-8-16(19)20(33)26-11-5-13-28-23(31-21)32-22/h1-3,6-9,25H,4-5,10-13H2,(H,26,33)(H4,24,27,28,30,31,32) |
| InChIKey | ASJYHQPBXFNMAG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 142.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|