C15H20O2 — CID 155550100
2-methyl-2-(3-methylbut-3-enyl)-3,4-dihydrochromen-6-ol (PubChem CID 155550100) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is 2-methyl-2-(3-methylbut-3-enyl)-3,4-dihydrochromen-6-ol.
| Compound Name | 2-methyl-2-(3-methylbut-3-enyl)-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 155550100 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 2-methyl-2-(3-methylbut-3-enyl)-3,4-dihydrochromen-6-ol |
| SMILES | C=C(C)CCC1(C)CCc2cc(O)ccc2O1 |
| InChI | InChI=1S/C15H20O2/c1-11(2)6-8-15(3)9-7-12-10-13(16)4-5-14(12)17-15/h4-5,10,16H,1,6-9H2,2-3H3 |
| InChIKey | YEKVFPDJBJSCQZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|