C22H24B4O2S2 — CID 155578791
CID 155578791 (PubChem CID 155578791) has the molecular formula C22H24B4O2S2 and a molecular weight of 427.81 g/mol.
| Compound Name | CID 155578791 |
|---|---|
| PubChem CID | 155578791 |
| Molecular Formula | C22H24B4O2S2 |
| Molecular Weight | 427.81 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | — |
| SMILES | [B]C([B])(CC(CCCC([B])([B])C(=O)O)SCc1ccccc1)SCc1ccccc1 |
| InChI | InChI=1S/C22H24B4O2S2/c23-21(24,20(27)28)13-7-12-19(29-15-17-8-3-1-4-9-17)14-22(25,26)30-16-18-10-5-2-6-11-18/h1-6,8-11,19H,7,12-16H2,(H,27,28) |
| InChIKey | JIWHKIBKMBYXMV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.81 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|