C16H16N2O2S — CID 155607270
5-(6-methoxyimidazo[2,1-b][1,3]benzothiazol-2-yl)-2-methylpent-4-enal (PubChem CID 155607270) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is 5-(6-methoxyimidazo[2,1-b][1,3]benzothiazol-2-yl)-2-methylpent-4-enal.
| Compound Name | 5-(6-methoxyimidazo[2,1-b][1,3]benzothiazol-2-yl)-2-methylpent-4-enal |
|---|---|
| PubChem CID | 155607270 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 5-(6-methoxyimidazo[2,1-b][1,3]benzothiazol-2-yl)-2-methylpent-4-enal |
| SMILES | COc1ccc2c(c1)sc1nc(C=CCC(C)C=O)cn12 |
| InChI | InChI=1S/C16H16N2O2S/c1-11(10-19)4-3-5-12-9-18-14-7-6-13(20-2)8-15(14)21-16(18)17-12/h3,5-11H,4H2,1-2H3 |
| InChIKey | KJWSDIKUNYXEFY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|