C20H20N6O — CID 155619735
(4aS,7aR)-6-[1-[(5-isocyano-2-pyridinyl)methyl]benzimidazol-2-yl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine (PubChem CID 155619735) has the molecular formula C20H20N6O and a molecular weight of 360.42 g/mol. Its IUPAC name is (4aS,7aR)-6-[1-[(5-isocyano-2-pyridinyl)methyl]benzimidazol-2-yl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aS,7aR)-6-[1-[(5-isocyano-2-pyridinyl)methyl]benzimidazol-2-yl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 155619735 |
| Molecular Formula | C20H20N6O |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | (4aS,7aR)-6-[1-[(5-isocyano-2-pyridinyl)methyl]benzimidazol-2-yl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine |
| SMILES | [C-]#[N+]c1ccc(Cn2c(N3C[C@@H]4NCCO[C@@H]4C3)nc3ccccc32)nc1 |
| InChI | InChI=1S/C20H20N6O/c1-21-14-6-7-15(23-10-14)11-26-18-5-3-2-4-16(18)24-20(26)25-12-17-19(13-25)27-9-8-22-17/h2-7,10,17,19,22H,8-9,11-13H2/t17-,19+/m0/s1 |
| InChIKey | ZJWVAGKALFTHKH-PKOBYXMFSA-N |
| XLogP | 2.21 |
| TPSA | 59.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|